C9H12F3N5OS — CID 47023521
2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 47023521) has the molecular formula C9H12F3N5OS and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 47023521 |
| Molecular Formula | C9H12F3N5OS |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=CCn1c(N)nnc1SCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H12F3N5OS/c1-2-3-17-7(13)15-16-8(17)19-4-6(18)14-5-9(10,11)12/h2H,1,3-5H2,(H2,13,15)(H,14,18) |
| InChIKey | JSPJHIOUPKISQL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|