C13H15FN4OS — CID 47023523
5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine (PubChem CID 47023523) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 47023523 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-amine |
| SMILES | C=CCn1c(N)nnc1SCc1cc(F)ccc1OC |
| InChI | InChI=1S/C13H15FN4OS/c1-3-6-18-12(15)16-17-13(18)20-8-9-7-10(14)4-5-11(9)19-2/h3-5,7H,1,6,8H2,2H3,(H2,15,16) |
| InChIKey | XPLHRAOQRXCAGJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|