C17H14FN3O3 — CID 47023949
2-(6-fluoro-4-oxoquinazolin-3-yl)-N-phenylmethoxyacetamide (PubChem CID 47023949) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-(6-fluoro-4-oxoquinazolin-3-yl)-N-phenylmethoxyacetamide.
| Compound Name | 2-(6-fluoro-4-oxoquinazolin-3-yl)-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 47023949 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(6-fluoro-4-oxoquinazolin-3-yl)-N-phenylmethoxyacetamide |
| SMILES | O=C(Cn1cnc2ccc(F)cc2c1=O)NOCc1ccccc1 |
| InChI | InChI=1S/C17H14FN3O3/c18-13-6-7-15-14(8-13)17(23)21(11-19-15)9-16(22)20-24-10-12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,20,22) |
| InChIKey | UMWUTDNAUHWRBT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|