C20H24FN3O3 — CID 47025093
1-[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl]-N-(furan-2-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 47025093) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl]-N-(furan-2-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl]-N-(furan-2-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47025093 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[2-(N-ethyl-4-fluoroanilino)-2-oxoethyl]-N-(furan-2-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(C(=O)CN1CCCC1C(=O)NCc1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN3O3/c1-2-24(16-9-7-15(21)8-10-16)19(25)14-23-11-3-6-18(23)20(26)22-13-17-5-4-12-27-17/h4-5,7-10,12,18H,2-3,6,11,13-14H2,1H3,(H,22,26) |
| InChIKey | WFNIUFMFXXBVFG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |