About 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine
4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 47025304) has the molecular formula C12H24N2O4S
and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine |
| PubChem CID | 47025304 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)N2CC(C)OC(C)C2)C(C)CO1 |
| InChI | InChI=1S/C12H24N2O4S/c1-9-8-17-10(2)7-14(9)19(15,16)13-5-11(3)18-12(4)6-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | QPCZQJZSIGMGRE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine?
The IUPAC name of 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine (CID 47025304) is 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine.
What is the SMILES notation for 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine?
The canonical SMILES for 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine is CC1CN(S(=O)(=O)N2CC(C)OC(C)C2)C(C)CO1.
What is the InChIKey of 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine?
The InChIKey is QPCZQJZSIGMGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O4S/c1-9-8-17-10(2)7-14(9)19(15,16)13-5-11(3)18-12(4)6-13/h9-12H,5-8H2,1-4H3.
What are the key properties of 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine?
4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine has a molecular weight of 292.40 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylmorpholin-4-yl)sulfonyl-2,6-dimethylmorpholine is sourced from PubChem (CID 47025304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).