C18H18FN3O2 — CID 47025358
2-[2-(4-fluorophenyl)-3-methyl-4-oxo-2H-quinazolin-1-yl]-N-methylacetamide (PubChem CID 47025358) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-3-methyl-4-oxo-2H-quinazolin-1-yl]-N-methylacetamide.
| Compound Name | 2-[2-(4-fluorophenyl)-3-methyl-4-oxo-2H-quinazolin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 47025358 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-3-methyl-4-oxo-2H-quinazolin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1c2ccccc2C(=O)N(C)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3O2/c1-20-16(23)11-22-15-6-4-3-5-14(15)18(24)21(2)17(22)12-7-9-13(19)10-8-12/h3-10,17H,11H2,1-2H3,(H,20,23) |
| InChIKey | CGYDVOYLLDLSIE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |