C8H7F3N6O — CID 4702671
3,3,3-trifluoro-N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)propanehydrazide (PubChem CID 4702671) has the molecular formula C8H7F3N6O and a molecular weight of 260.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)propanehydrazide.
| Compound Name | 3,3,3-trifluoro-N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)propanehydrazide |
|---|---|
| PubChem CID | 4702671 |
| Molecular Formula | C8H7F3N6O |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3,3,3-trifluoro-N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)propanehydrazide |
| SMILES | O=C(CC(F)(F)F)NNc1ccc2nncn2n1 |
| InChI | InChI=1S/C8H7F3N6O/c9-8(10,11)3-7(18)15-13-5-1-2-6-14-12-4-17(6)16-5/h1-2,4H,3H2,(H,13,16)(H,15,18) |
| InChIKey | ADIFGRDYEJVSKR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|