About (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate
(2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate (PubChem CID 47027372) has the molecular formula C16H14BrNO6S
and a molecular weight of 428.26 g/mol. Its IUPAC name is (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
Molecular Properties
| Compound Name | (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| PubChem CID | 47027372 |
| Molecular Formula | C16H14BrNO6S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| SMILES | COc1cc(C)ccc1OS(=O)(=O)c1cc2c(cc1Br)NC(=O)CO2 |
| InChI | InChI=1S/C16H14BrNO6S/c1-9-3-4-12(14(5-9)22-2)24-25(20,21)15-7-13-11(6-10(15)17)18-16(19)8-23-13/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | CINWZNDNBYGEGF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The IUPAC name of (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate (CID 47027372) is (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
What is the SMILES notation for (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The canonical SMILES for (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate is COc1cc(C)ccc1OS(=O)(=O)c1cc2c(cc1Br)NC(=O)CO2.
What is the InChIKey of (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
The InChIKey is CINWZNDNBYGEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrNO6S/c1-9-3-4-12(14(5-9)22-2)24-25(20,21)15-7-13-11(6-10(15)17)18-16(19)8-23-13/h3-7H,8H2,1-2H3,(H,18,19).
What are the key properties of (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate?
(2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate has a molecular weight of 428.26 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-methylphenyl) 6-bromo-3-oxo-4H-1,4-benzoxazine-7-sulfonate is sourced from PubChem (CID 47027372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).