About 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane
3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane (PubChem CID 47027402) has the molecular formula C10H22N2O4S2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane.
Molecular Properties
| Compound Name | 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane |
| PubChem CID | 47027402 |
| Molecular Formula | C10H22N2O4S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane |
| SMILES | CCCCN(C)S(=O)(=O)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H22N2O4S2/c1-3-4-6-12(2)18(15,16)11-8-10-5-7-17(13,14)9-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | MNZRUACDWQYPRP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane?
The IUPAC name of 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane (CID 47027402) is 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane.
What is the SMILES notation for 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane?
The canonical SMILES for 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane is CCCCN(C)S(=O)(=O)NCC1CCS(=O)(=O)C1.
What is the InChIKey of 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane?
The InChIKey is MNZRUACDWQYPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O4S2/c1-3-4-6-12(2)18(15,16)11-8-10-5-7-17(13,14)9-10/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane?
3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane has a molecular weight of 298.43 g/mol, XLogP of -0.01, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[butyl(methyl)sulfamoyl]amino]methyl]-1,1-dioxothiolane is sourced from PubChem (CID 47027402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).