C13H22N4O5S — CID 47027405
8-(2,6-dimethylmorpholin-4-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 47027405) has the molecular formula C13H22N4O5S and a molecular weight of 346.41 g/mol. Its IUPAC name is 8-(2,6-dimethylmorpholin-4-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2,6-dimethylmorpholin-4-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 47027405 |
| Molecular Formula | C13H22N4O5S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 8-(2,6-dimethylmorpholin-4-yl)sulfonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CN(S(=O)(=O)N2CCC3(CC2)NC(=O)NC3=O)CC(C)O1 |
| InChI | InChI=1S/C13H22N4O5S/c1-9-7-17(8-10(2)22-9)23(20,21)16-5-3-13(4-6-16)11(18)14-12(19)15-13/h9-10H,3-8H2,1-2H3,(H2,14,15,18,19) |
| InChIKey | PPJMSRQBIMWBBV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|