About N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide
N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide (PubChem CID 47028009) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide |
| PubChem CID | 47028009 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCC(C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-10-5-6-19-14(10)15(18)16-7-11(2)17-8-12(3)20-13(4)9-17/h5-6,11-13H,7-9H2,1-4H3,(H,16,18) |
| InChIKey | TVNXDYWJKHUFCG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide?
The IUPAC name of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide (CID 47028009) is N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide.
What is the SMILES notation for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide?
The canonical SMILES for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide is Cc1ccoc1C(=O)NCC(C)N1CC(C)OC(C)C1.
What is the InChIKey of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide?
The InChIKey is TVNXDYWJKHUFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-10-5-6-19-14(10)15(18)16-7-11(2)17-8-12(3)20-13(4)9-17/h5-6,11-13H,7-9H2,1-4H3,(H,16,18).
What are the key properties of N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide?
N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide has a molecular weight of 280.37 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dimethylmorpholin-4-yl)propyl]-3-methylfuran-2-carboxamide is sourced from PubChem (CID 47028009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).