About 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole
2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole (PubChem CID 47028193) has the molecular formula C17H21ClN2O3S
and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole |
| PubChem CID | 47028193 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole |
| SMILES | COCCn1c(SCc2cc(Cl)cc3c2OCOC3)nc(C)c1C |
| InChI | InChI=1S/C17H21ClN2O3S/c1-11-12(2)20(4-5-21-3)17(19-11)24-9-14-7-15(18)6-13-8-22-10-23-16(13)14/h6-7H,4-5,8-10H2,1-3H3 |
| InChIKey | YUHXELQDUBNKTF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole?
The IUPAC name of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole (CID 47028193) is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole.
What is the SMILES notation for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole?
The canonical SMILES for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole is COCCn1c(SCc2cc(Cl)cc3c2OCOC3)nc(C)c1C.
What is the InChIKey of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole?
The InChIKey is YUHXELQDUBNKTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2O3S/c1-11-12(2)20(4-5-21-3)17(19-11)24-9-14-7-15(18)6-13-8-22-10-23-16(13)14/h6-7H,4-5,8-10H2,1-3H3.
What are the key properties of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole?
2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole has a molecular weight of 368.89 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1-(2-methoxyethyl)-4,5-dimethylimidazole is sourced from PubChem (CID 47028193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).