C12H18N2O3S — CID 47028344
N-(3,4-dimethylphenyl)-3-(methanesulfonamido)propanamide (PubChem CID 47028344) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-(methanesulfonamido)propanamide.
| Compound Name | N-(3,4-dimethylphenyl)-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 47028344 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-(methanesulfonamido)propanamide |
| SMILES | Cc1ccc(NC(=O)CCNS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C12H18N2O3S/c1-9-4-5-11(8-10(9)2)14-12(15)6-7-13-18(3,16)17/h4-5,8,13H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | KNMSXIHIVYFTEH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |