C20H24N2O2 — CID 47029217
N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3-dimethylbenzamide (PubChem CID 47029217) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3-dimethylbenzamide.
| Compound Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 47029217 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCc2cccnc2OC2CCCC2)c1C |
| InChI | InChI=1S/C20H24N2O2/c1-14-7-5-11-18(15(14)2)19(23)22-13-16-8-6-12-21-20(16)24-17-9-3-4-10-17/h5-8,11-12,17H,3-4,9-10,13H2,1-2H3,(H,22,23) |
| InChIKey | MUHGJLHRKRTIMI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |