C20H27FN2O3 — CID 47029503
methyl 1-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 47029503) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is methyl 1-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 47029503 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl 1-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1CC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O3/c1-26-20(25)18-12-15-4-2-3-5-17(15)23(18)13-19(24)22-11-10-14-6-8-16(21)9-7-14/h6-9,15,17-18H,2-5,10-13H2,1H3,(H,22,24) |
| InChIKey | BKILBIOFQJOBOM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |