C16H20N2O3S — CID 47029568
2-oxo-N,N-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide (PubChem CID 47029568) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-oxo-N,N-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide.
| Compound Name | 2-oxo-N,N-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
|---|---|
| PubChem CID | 47029568 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-oxo-N,N-bis(prop-2-enyl)-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C16H20N2O3S/c1-3-10-18(11-4-2)22(20,21)14-8-9-15-13(12-14)6-5-7-16(19)17-15/h3-4,8-9,12H,1-2,5-7,10-11H2,(H,17,19) |
| InChIKey | BPVICFGALVDUTI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|