About 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide
3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide (PubChem CID 47029801) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide.
Molecular Properties
| Compound Name | 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide |
| PubChem CID | 47029801 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide |
| SMILES | CC(C)CC(=O)NCCCn1cncn1 |
| InChI | InChI=1S/C10H18N4O/c1-9(2)6-10(15)12-4-3-5-14-8-11-7-13-14/h7-9H,3-6H2,1-2H3,(H,12,15) |
| InChIKey | DAJFJUCANOBQBS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide?
The IUPAC name of 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide (CID 47029801) is 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide.
What is the SMILES notation for 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide?
The canonical SMILES for 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide is CC(C)CC(=O)NCCCn1cncn1.
What is the InChIKey of 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide?
The InChIKey is DAJFJUCANOBQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-9(2)6-10(15)12-4-3-5-14-8-11-7-13-14/h7-9H,3-6H2,1-2H3,(H,12,15).
What are the key properties of 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide?
3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide has a molecular weight of 210.28 g/mol, XLogP of 0.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide is sourced from PubChem (CID 47029801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).