C11H20N4O — CID 47029802
3,3-dimethyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide (PubChem CID 47029802) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3,3-dimethyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 47029802 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3,3-dimethyl-N-[3-(1,2,4-triazol-1-yl)propyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCCCn1cncn1 |
| InChI | InChI=1S/C11H20N4O/c1-11(2,3)7-10(16)13-5-4-6-15-9-12-8-14-15/h8-9H,4-7H2,1-3H3,(H,13,16) |
| InChIKey | CWKOWESCPRJUIL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|