C23H26ClN3O2 — CID 47030657
N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-(3-phenoxyphenyl)methanamine;hydrochloride (PubChem CID 47030657) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-(3-phenoxyphenyl)methanamine;hydrochloride.
| Compound Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-(3-phenoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 47030657 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-(3-phenoxyphenyl)methanamine;hydrochloride |
| SMILES | Cl.c1ccc(Oc2cccc(CNCc3cccnc3N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C23H25N3O2.ClH/c1-2-8-21(9-3-1)28-22-10-4-6-19(16-22)17-24-18-20-7-5-11-25-23(20)26-12-14-27-15-13-26;/h1-11,16,24H,12-15,17-18H2;1H |
| InChIKey | WQWIFCKGUZPBFI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |