About 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine
1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine (PubChem CID 47030720) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine |
| PubChem CID | 47030720 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine |
| SMILES | COc1cc(CNC(C)Cn2cccn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H23N3O3/c1-12(11-19-7-5-6-18-19)17-10-13-8-14(20-2)16(22-4)15(9-13)21-3/h5-9,12,17H,10-11H2,1-4H3 |
| InChIKey | MDGBIGDIXXFTEN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine?
The IUPAC name of 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine (CID 47030720) is 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine.
What is the SMILES notation for 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine?
The canonical SMILES for 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine is COc1cc(CNC(C)Cn2cccn2)cc(OC)c1OC.
What is the InChIKey of 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine?
The InChIKey is MDGBIGDIXXFTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-12(11-19-7-5-6-18-19)17-10-13-8-14(20-2)16(22-4)15(9-13)21-3/h5-9,12,17H,10-11H2,1-4H3.
What are the key properties of 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine?
1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine has a molecular weight of 305.38 g/mol, XLogP of 2.09, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazol-1-yl-N-[(3,4,5-trimethoxyphenyl)methyl]propan-2-amine is sourced from PubChem (CID 47030720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).