C16H22FN3O2S — CID 47030793
1-(2-fluorophenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea (PubChem CID 47030793) has the molecular formula C16H22FN3O2S and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 47030793 |
| Molecular Formula | C16H22FN3O2S |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]urea |
| SMILES | O=C(NCC1(N2CCOCC2)CCSC1)Nc1ccccc1F |
| InChI | InChI=1S/C16H22FN3O2S/c17-13-3-1-2-4-14(13)19-15(21)18-11-16(5-10-23-12-16)20-6-8-22-9-7-20/h1-4H,5-12H2,(H2,18,19,21) |
| InChIKey | VBFNHDJLLYOVPL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |