C11H19F3N2O3 — CID 47031355
2-methyl-N-[2-[2-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]propanamide (PubChem CID 47031355) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 47031355 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-methyl-N-[2-[2-(2,2,2-trifluoroethoxy)propanoylamino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)C(C)OCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-7(2)9(17)15-4-5-16-10(18)8(3)19-6-11(12,13)14/h7-8H,4-6H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | YKMMRPDQRJYHLZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|