C21H28N4O3S — CID 47032078
1-[2-(benzylsulfonylamino)ethyl]-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 47032078) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[2-(benzylsulfonylamino)ethyl]-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[2-(benzylsulfonylamino)ethyl]-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 47032078 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-[2-(benzylsulfonylamino)ethyl]-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | O=C(NCCNS(=O)(=O)Cc1ccccc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c26-21(22-13-14-23-29(27,28)17-18-7-3-1-4-8-18)24-19-9-11-20(12-10-19)25-15-5-2-6-16-25/h1,3-4,7-12,23H,2,5-6,13-17H2,(H2,22,24,26) |
| InChIKey | TUDXWSIVSSWLKS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|