C13H14F2N4O — CID 47032156
1-(3,4-difluorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 47032156) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 47032156 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | Cc1nn(C)c(C)c1NC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2N4O/c1-7-12(8(2)19(3)18-7)17-13(20)16-9-4-5-10(14)11(15)6-9/h4-6H,1-3H3,(H2,16,17,20) |
| InChIKey | VSDKJUZTWHVWOT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |