C21H27N3O5S — CID 47032415
1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-(2-phenoxyphenyl)urea (PubChem CID 47032415) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-(2-phenoxyphenyl)urea.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-(2-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 47032415 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)sulfonylethyl]-3-(2-phenoxyphenyl)urea |
| SMILES | CC1CN(S(=O)(=O)CCNC(=O)Nc2ccccc2Oc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C21H27N3O5S/c1-16-14-24(15-17(2)28-16)30(26,27)13-12-22-21(25)23-19-10-6-7-11-20(19)29-18-8-4-3-5-9-18/h3-11,16-17H,12-15H2,1-2H3,(H2,22,23,25) |
| InChIKey | GKQYMQARCMZVHY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |