About 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole
5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole (PubChem CID 47034121) has the molecular formula C12H9N3S2
and a molecular weight of 259.36 g/mol. Its IUPAC name is 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole |
| PubChem CID | 47034121 |
| Molecular Formula | C12H9N3S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole |
| SMILES | Cc1ccc2sc(/C=C/c3csnn3)nc2c1 |
| InChI | InChI=1S/C12H9N3S2/c1-8-2-4-11-10(6-8)13-12(17-11)5-3-9-7-16-15-14-9/h2-7H,1H3/b5-3+ |
| InChIKey | UNXSYGXUQDXEPL-HWKANZROSA-N |
| XLogP | 3.63 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole?
The IUPAC name of 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole (CID 47034121) is 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole.
What is the SMILES notation for 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole?
The canonical SMILES for 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole is Cc1ccc2sc(/C=C/c3csnn3)nc2c1.
What is the InChIKey of 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole?
The InChIKey is UNXSYGXUQDXEPL-HWKANZROSA-N. The full InChI is InChI=1S/C12H9N3S2/c1-8-2-4-11-10(6-8)13-12(17-11)5-3-9-7-16-15-14-9/h2-7H,1H3/b5-3+.
What are the key properties of 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole?
5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole has a molecular weight of 259.36 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[(E)-2-(thiadiazol-4-yl)ethenyl]-1,3-benzothiazole is sourced from PubChem (CID 47034121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).