C20H22N6S2 — CID 47034322
N,2-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 47034322) has the molecular formula C20H22N6S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is N,2-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N,2-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 47034322 |
| Molecular Formula | C20H22N6S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N,2-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N(C)Cc2nnc3n2CCCCC3)c2c(-c3cccs3)csc2n1 |
| InChI | InChI=1S/C20H22N6S2/c1-13-21-19(18-14(12-28-20(18)22-13)15-7-6-10-27-15)25(2)11-17-24-23-16-8-4-3-5-9-26(16)17/h6-7,10,12H,3-5,8-9,11H2,1-2H3 |
| InChIKey | ZQGXRBXXFVSVKO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |