C37H33N5O3S2 — CID 4703502
5-(4-tert-butylphenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 4703502) has the molecular formula C37H33N5O3S2 and a molecular weight of 659.84 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-tert-butylphenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4703502 |
| Molecular Formula | C37H33N5O3S2 |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | Cc1cccn2c(C)c(C(O)=C3C(=O)C(=O)N(c4nnc(SCc5cccc6ccccc56)s4)C3c3ccc(C(C)(C)C)cc3)nc12 |
| InChI | InChI=1S/C37H33N5O3S2/c1-21-10-9-19-41-22(2)29(38-33(21)41)31(43)28-30(24-15-17-26(18-16-24)37(3,4)5)42(34(45)32(28)44)35-39-40-36(47-35)46-20-25-13-8-12-23-11-6-7-14-27(23)25/h6-19,30,43H,20H2,1-5H3 |
| InChIKey | ATYBVOJIYQPPJW-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|