About N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide
N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide (PubChem CID 47035530) has the molecular formula C13H11N5O2
and a molecular weight of 269.26 g/mol. Its IUPAC name is N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide |
| PubChem CID | 47035530 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCc1ccc(-n2cncn2)nc1)c1ccoc1 |
| InChI | InChI=1S/C13H11N5O2/c19-13(11-3-4-20-7-11)16-6-10-1-2-12(15-5-10)18-9-14-8-17-18/h1-5,7-9H,6H2,(H,16,19) |
| InChIKey | RKVAYOZLOADNKE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide?
The IUPAC name of N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide (CID 47035530) is N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide.
What is the SMILES notation for N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide?
The canonical SMILES for N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide is O=C(NCc1ccc(-n2cncn2)nc1)c1ccoc1.
What is the InChIKey of N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide?
The InChIKey is RKVAYOZLOADNKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O2/c19-13(11-3-4-20-7-11)16-6-10-1-2-12(15-5-10)18-9-14-8-17-18/h1-5,7-9H,6H2,(H,16,19).
What are the key properties of N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide?
N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide has a molecular weight of 269.26 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]furan-3-carboxamide is sourced from PubChem (CID 47035530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).