About 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide
2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide (PubChem CID 47035811) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide |
| PubChem CID | 47035811 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide |
| SMILES | CCOC(C)C(=O)NCc1nc(C)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-4-14-8(3)10(13)11-5-9-12-7(2)6-15-9/h6,8H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | HRAVOHNWTFGHTL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide?
The IUPAC name of 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide (CID 47035811) is 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide.
What is the SMILES notation for 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide?
The canonical SMILES for 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide is CCOC(C)C(=O)NCc1nc(C)cs1.
What is the InChIKey of 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide?
The InChIKey is HRAVOHNWTFGHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-4-14-8(3)10(13)11-5-9-12-7(2)6-15-9/h6,8H,4-5H2,1-3H3,(H,11,13).
What are the key properties of 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide?
2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide has a molecular weight of 228.32 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide is sourced from PubChem (CID 47035811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).