C31H28N4O4S — CID 4703660
4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 4703660) has the molecular formula C31H28N4O4S and a molecular weight of 552.66 g/mol. Its IUPAC name is 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4703660 |
| Molecular Formula | C31H28N4O4S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4nc5c(C)cccn5c4C)C3c3ccc(CC)cc3)sc2c1 |
| InChI | InChI=1S/C31H28N4O4S/c1-5-19-9-11-20(12-10-19)26-24(27(36)25-18(4)34-15-7-8-17(3)29(34)33-25)28(37)30(38)35(26)31-32-22-14-13-21(39-6-2)16-23(22)40-31/h7-16,26,36H,5-6H2,1-4H3 |
| InChIKey | TYXZJURILFSSCI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|