C17H18N6O — CID 47036694
2-(1-phenylpyrazol-4-yl)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide (PubChem CID 47036694) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-(1-phenylpyrazol-4-yl)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-(1-phenylpyrazol-4-yl)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 47036694 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-(1-phenylpyrazol-4-yl)-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
| SMILES | O=C(Cc1cnn(-c2ccccc2)c1)NCCNc1ncccn1 |
| InChI | InChI=1S/C17H18N6O/c24-16(18-9-10-21-17-19-7-4-8-20-17)11-14-12-22-23(13-14)15-5-2-1-3-6-15/h1-8,12-13H,9-11H2,(H,18,24)(H,19,20,21) |
| InChIKey | YBJQIHACPASORC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|