About 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide
4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide (PubChem CID 47036755) has the molecular formula C18H13N5O3
and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide |
| PubChem CID | 47036755 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide |
| SMILES | O=C(NCc1cccnc1-n1cncn1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C18H13N5O3/c24-14-8-16(26-15-6-2-1-5-13(14)15)18(25)21-9-12-4-3-7-20-17(12)23-11-19-10-22-23/h1-8,10-11H,9H2,(H,21,25) |
| InChIKey | BOHDXGJZYSZTLU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide?
The IUPAC name of 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide (CID 47036755) is 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide.
What is the SMILES notation for 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide?
The canonical SMILES for 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide is O=C(NCc1cccnc1-n1cncn1)c1cc(=O)c2ccccc2o1.
What is the InChIKey of 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide?
The InChIKey is BOHDXGJZYSZTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O3/c24-14-8-16(26-15-6-2-1-5-13(14)15)18(25)21-9-12-4-3-7-20-17(12)23-11-19-10-22-23/h1-8,10-11H,9H2,(H,21,25).
What are the key properties of 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide?
4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide has a molecular weight of 347.33 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]chromene-2-carboxamide is sourced from PubChem (CID 47036755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).