C17H19ClN6O3 — CID 47038390
5-chloro-N-[2-(2-nitroanilino)ethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 47038390) has the molecular formula C17H19ClN6O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-nitroanilino)ethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(2-nitroanilino)ethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47038390 |
| Molecular Formula | C17H19ClN6O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 5-chloro-N-[2-(2-nitroanilino)ethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C17H19ClN6O3/c18-12-11-21-17(23-9-3-4-10-23)22-15(12)16(25)20-8-7-19-13-5-1-2-6-14(13)24(26)27/h1-2,5-6,11,19H,3-4,7-10H2,(H,20,25) |
| InChIKey | SIMGNNUFAUXOPK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|