C15H18N4O3 — CID 47038574
4-ethoxy-N-[2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]benzamide (PubChem CID 47038574) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 47038574 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-ethoxy-N-[2-[(5-methyl-1H-pyrazol-3-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2cc(C)[nH]n2)cc1 |
| InChI | InChI=1S/C15H18N4O3/c1-3-22-12-6-4-11(5-7-12)15(21)16-9-14(20)17-13-8-10(2)18-19-13/h4-8H,3,9H2,1-2H3,(H,16,21)(H2,17,18,19,20) |
| InChIKey | UOIFLMDEKOEWPT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |