C20H24N4O3 — CID 47039732
1-[2-(3-methylphenoxy)ethyl]-3-[4-(3-oxopiperazin-1-yl)phenyl]urea (PubChem CID 47039732) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[2-(3-methylphenoxy)ethyl]-3-[4-(3-oxopiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[2-(3-methylphenoxy)ethyl]-3-[4-(3-oxopiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 47039732 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[2-(3-methylphenoxy)ethyl]-3-[4-(3-oxopiperazin-1-yl)phenyl]urea |
| SMILES | Cc1cccc(OCCNC(=O)Nc2ccc(N3CCNC(=O)C3)cc2)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-15-3-2-4-18(13-15)27-12-10-22-20(26)23-16-5-7-17(8-6-16)24-11-9-21-19(25)14-24/h2-8,13H,9-12,14H2,1H3,(H,21,25)(H2,22,23,26) |
| InChIKey | FRXUMZXHZHHOPD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|