C19H24N6O3S — CID 47040109
1-[2-(benzylsulfonylamino)ethyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea (PubChem CID 47040109) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[2-(benzylsulfonylamino)ethyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea.
| Compound Name | 1-[2-(benzylsulfonylamino)ethyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
|---|---|
| PubChem CID | 47040109 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[2-(benzylsulfonylamino)ethyl]-3-(1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)urea |
| SMILES | CC(C)n1ncc2cc(NC(=O)NCCNS(=O)(=O)Cc3ccccc3)cnc21 |
| InChI | InChI=1S/C19H24N6O3S/c1-14(2)25-18-16(11-22-25)10-17(12-21-18)24-19(26)20-8-9-23-29(27,28)13-15-6-4-3-5-7-15/h3-7,10-12,14,23H,8-9,13H2,1-2H3,(H2,20,24,26) |
| InChIKey | PCTZRTWOZIVBOY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|