About (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone
(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (PubChem CID 47041435) has the molecular formula C16H15N3O2S
and a molecular weight of 313.38 g/mol. Its IUPAC name is (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| PubChem CID | 47041435 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone |
| SMILES | Cc1noc2ncc(C(=O)N3CCCC3c3ccsc3)cc12 |
| InChI | InChI=1S/C16H15N3O2S/c1-10-13-7-12(8-17-15(13)21-18-10)16(20)19-5-2-3-14(19)11-4-6-22-9-11/h4,6-9,14H,2-3,5H2,1H3 |
| InChIKey | KRJJYFSYAIJVQM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone?
The IUPAC name of (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone (CID 47041435) is (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone.
What is the SMILES notation for (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone?
The canonical SMILES for (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone is Cc1noc2ncc(C(=O)N3CCCC3c3ccsc3)cc12.
What is the InChIKey of (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone?
The InChIKey is KRJJYFSYAIJVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2S/c1-10-13-7-12(8-17-15(13)21-18-10)16(20)19-5-2-3-14(19)11-4-6-22-9-11/h4,6-9,14H,2-3,5H2,1H3.
What are the key properties of (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone?
(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone has a molecular weight of 313.38 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)-(2-thiophen-3-ylpyrrolidin-1-yl)methanone is sourced from PubChem (CID 47041435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).