C23H36N4O2 — CID 47041657
4-(azepan-1-ylmethyl)-N-[2-methyl-5-(propanoylamino)phenyl]piperidine-1-carboxamide (PubChem CID 47041657) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-[2-methyl-5-(propanoylamino)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-[2-methyl-5-(propanoylamino)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47041657 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-[2-methyl-5-(propanoylamino)phenyl]piperidine-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(C)c(NC(=O)N2CCC(CN3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H36N4O2/c1-3-22(28)24-20-9-8-18(2)21(16-20)25-23(29)27-14-10-19(11-15-27)17-26-12-6-4-5-7-13-26/h8-9,16,19H,3-7,10-15,17H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | QXSHWNAWUKFCGR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |