C17H15F2N3O3 — CID 47041970
(2,4-difluorophenyl)-[4-(3-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 47041970) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[4-(3-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47041970 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2,4-difluorophenyl)-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1F)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H15F2N3O3/c18-12-4-5-15(16(19)10-12)17(23)21-8-6-20(7-9-21)13-2-1-3-14(11-13)22(24)25/h1-5,10-11H,6-9H2 |
| InChIKey | XZCPDSRMHLMVRG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|