C10H11N3O2 — CID 47042553
1-(2-methoxy-3-pyridinyl)-3-prop-2-ynylurea (PubChem CID 47042553) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-3-prop-2-ynylurea.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 47042553 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)Nc1cccnc1OC |
| InChI | InChI=1S/C10H11N3O2/c1-3-6-12-10(14)13-8-5-4-7-11-9(8)15-2/h1,4-5,7H,6H2,2H3,(H2,12,13,14) |
| InChIKey | ULJNPFLMIRIXOJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|