C11H16F3N3OS — CID 47042769
N-[2-(trifluoromethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 47042769) has the molecular formula C11H16F3N3OS and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 47042769 |
| Molecular Formula | C11H16F3N3OS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3OS/c1-7-9(8(2)17(3)16-7)6-10(18)15-4-5-19-11(12,13)14/h4-6H2,1-3H3,(H,15,18) |
| InChIKey | UNVCRRYNZGTQAT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|