C21H29ClN4O3 — CID 47043061
N'-[2-chloro-5-(2-oxopyrrolidin-1-yl)phenyl]-N-[[1-(dimethylamino)cyclohexyl]methyl]oxamide (PubChem CID 47043061) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is N'-[2-chloro-5-(2-oxopyrrolidin-1-yl)phenyl]-N-[[1-(dimethylamino)cyclohexyl]methyl]oxamide.
| Compound Name | N'-[2-chloro-5-(2-oxopyrrolidin-1-yl)phenyl]-N-[[1-(dimethylamino)cyclohexyl]methyl]oxamide |
|---|---|
| PubChem CID | 47043061 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N'-[2-chloro-5-(2-oxopyrrolidin-1-yl)phenyl]-N-[[1-(dimethylamino)cyclohexyl]methyl]oxamide |
| SMILES | CN(C)C1(CNC(=O)C(=O)Nc2cc(N3CCCC3=O)ccc2Cl)CCCCC1 |
| InChI | InChI=1S/C21H29ClN4O3/c1-25(2)21(10-4-3-5-11-21)14-23-19(28)20(29)24-17-13-15(8-9-16(17)22)26-12-6-7-18(26)27/h8-9,13H,3-7,10-12,14H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | PMMHXDVVDCOMCS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|