C21H27N5O2 — CID 47043133
N-[3-(imidazol-1-ylmethyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 47043133) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[3-(imidazol-1-ylmethyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[3-(imidazol-1-ylmethyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47043133 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[3-(imidazol-1-ylmethyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cn2ccnc2)c1)C1CCCN(C(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C21H27N5O2/c27-20(18-6-4-11-26(15-18)21(28)25-9-1-2-10-25)23-19-7-3-5-17(13-19)14-24-12-8-22-16-24/h3,5,7-8,12-13,16,18H,1-2,4,6,9-11,14-15H2,(H,23,27) |
| InChIKey | LGTBRPFDGDBTCL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |