C24H28N4O3 — CID 47044298
N-(2,6-diethylphenyl)-N'-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]oxamide (PubChem CID 47044298) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N'-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]oxamide.
| Compound Name | N-(2,6-diethylphenyl)-N'-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 47044298 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(2,6-diethylphenyl)-N'-[(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)NC(c1cccc(OC)c1)c1nccn1C |
| InChI | InChI=1S/C24H28N4O3/c1-5-16-9-7-10-17(6-2)20(16)26-23(29)24(30)27-21(22-25-13-14-28(22)3)18-11-8-12-19(15-18)31-4/h7-15,21H,5-6H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | QJWSJFLBUGDTCG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|