C15H19FN2O3S2 — CID 47044715
O-propan-2-yl [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl]sulfanylmethanethioate (PubChem CID 47044715) has the molecular formula C15H19FN2O3S2 and a molecular weight of 358.46 g/mol. Its IUPAC name is O-propan-2-yl [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-propan-2-yl [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 47044715 |
| Molecular Formula | C15H19FN2O3S2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | O-propan-2-yl [2-(N-(3-amino-3-oxopropyl)-4-fluoroanilino)-2-oxoethyl]sulfanylmethanethioate |
| SMILES | CC(C)OC(=S)SCC(=O)N(CCC(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O3S2/c1-10(2)21-15(22)23-9-14(20)18(8-7-13(17)19)12-5-3-11(16)4-6-12/h3-6,10H,7-9H2,1-2H3,(H2,17,19) |
| InChIKey | RNJDQCIPMLQOFB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|