C16H25N5O — CID 47045763
1-[2-(cyclohexen-1-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea (PubChem CID 47045763) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 47045763 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCCC1=CCCCC1)NCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C16H25N5O/c22-16(17-10-9-13-6-2-1-3-7-13)18-12-15-20-19-14-8-4-5-11-21(14)15/h6H,1-5,7-12H2,(H2,17,18,22) |
| InChIKey | HYWMXQMNIROHCY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|