About 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione
3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione (PubChem CID 47046149) has the molecular formula C15H10F2O4
and a molecular weight of 292.24 g/mol. Its IUPAC name is 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione.
Molecular Properties
| Compound Name | 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| PubChem CID | 47046149 |
| Molecular Formula | C15H10F2O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione |
| SMILES | CC1=CC(=O)C(C(=O)/C=C/c2cc(F)ccc2F)C(=O)O1 |
| InChI | InChI=1S/C15H10F2O4/c1-8-6-13(19)14(15(20)21-8)12(18)5-2-9-7-10(16)3-4-11(9)17/h2-7,14H,1H3/b5-2+ |
| InChIKey | QTQWPLODBFTDTB-GORDUTHDSA-N |
| XLogP | 2.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione?
The IUPAC name of 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione (CID 47046149) is 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione.
What is the SMILES notation for 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione?
The canonical SMILES for 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione is CC1=CC(=O)C(C(=O)/C=C/c2cc(F)ccc2F)C(=O)O1.
What is the InChIKey of 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione?
The InChIKey is QTQWPLODBFTDTB-GORDUTHDSA-N. The full InChI is InChI=1S/C15H10F2O4/c1-8-6-13(19)14(15(20)21-8)12(18)5-2-9-7-10(16)3-4-11(9)17/h2-7,14H,1H3/b5-2+.
What are the key properties of 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione?
3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione has a molecular weight of 292.24 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(2,5-difluorophenyl)prop-2-enoyl]-6-methylpyran-2,4-dione is sourced from PubChem (CID 47046149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).