C19H28N2O4S — CID 47046893
1-(2-cyclopentyloxyacetyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 47046893) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-(2-cyclopentyloxyacetyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2-cyclopentyloxyacetyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 47046893 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(2-cyclopentyloxyacetyl)-N,N-diethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC1CCCC1 |
| InChI | InChI=1S/C19H28N2O4S/c1-3-20(4-2)26(23,24)17-9-10-18-15(13-17)11-12-21(18)19(22)14-25-16-7-5-6-8-16/h9-10,13,16H,3-8,11-12,14H2,1-2H3 |
| InChIKey | YLATYFWXKBRNMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |