C18H19N3O3S — CID 47047630
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 47047630) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 47047630 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCc1nc(NC(=O)c2ccc(CN3C(=O)CCC3=O)cc2)sc1C |
| InChI | InChI=1S/C18H19N3O3S/c1-3-14-11(2)25-18(19-14)20-17(24)13-6-4-12(5-7-13)10-21-15(22)8-9-16(21)23/h4-7H,3,8-10H2,1-2H3,(H,19,20,24) |
| InChIKey | LHSRTWFPDZXIDI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|